cas: 859745-06-5 — see every product listed under this CAS number, including other names
7-Chlorodibenzo[c,h]acridine, 97%, 97% (CAS 859745-06-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNJ7-250mg |
| cas | 859745-06-5 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 237.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
13-chloro-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,10,13,15,17,19,21-undecaene (CAS 859745-06-5) is a chemical compound with the molecular formula C21H12ClN and a molecular weight of 313.8 g/mol. IUPAC name: 13-chloro-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,10,13,15,17,19,21-undecaene. InChIKey: KXAUQHJDRHPCPU-UHFFFAOYSA-N.
| Molecular formula | C21H12ClN |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | 13-chloro-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,10,13,15,17,19,21-undecaene |
| InChIKey | KXAUQHJDRHPCPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2N=C4C(=C3Cl)C=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)