cas: 71387-69-4 — see every product listed under this CAS number, including other names
7-Ethoxy-2H-benzo(b)(1,4)thiazin-3(4H)-one, 97% (CAS 71387-69-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A163536-5g |
| cas | 71387-69-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10733.38 Pln | |
| AmBeed | 10g | 16065.07 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-ethoxy-4H-1,4-benzothiazin-3-one (CAS 71387-69-4) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 7-ethoxy-4H-1,4-benzothiazin-3-one. InChIKey: UYUUNYNVHRTORT-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 7-ethoxy-4H-1,4-benzothiazin-3-one |
| InChIKey | UYUUNYNVHRTORT-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)NC(=O)CS2 |
Computed by PubChem (NCBI)