cas: 1128-74-1 — see every product listed under this CAS number, including other names
7-Fluoro-2-methylquinoline, >97%, >97% (CAS 1128-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 10g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NFA-100mg |
| cas | 1128-74-1 |
| size | 100mg |
| availability | 124g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 25g | 794.00 Pln | |
| Chemat | 100g | 2618.00 Pln | |
| Chemat | 10g | 366.80 Pln | |
| Chemat | 50g | 1432.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
7-fluoro-2-methylquinoline (CAS 1128-74-1) is a chemical compound with the molecular formula C10H8FN and a molecular weight of 161.18 g/mol. IUPAC name: 7-fluoro-2-methylquinoline. InChIKey: AYSKNDXTWPNRKG-UHFFFAOYSA-N.
| Molecular formula | C10H8FN |
|---|---|
| Molecular weight | 161.18 g/mol |
| IUPAC name | 7-fluoro-2-methylquinoline |
| InChIKey | AYSKNDXTWPNRKG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=C2)F |
Computed by PubChem (NCBI)