cas: 1333252-74-6 — see every product listed under this CAS number, including other names
7-Fluoro-4-(piperazin-1-yl)quinoline Hydrochloride, ≥95%, ≥95% (CAS 1333252-74-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSVH-1g |
| cas | 1333252-74-6 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2373.20 Pln | |
| Chemat | 5g | 10058.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
7-fluoro-4-piperazin-1-ylquinoline;hydrochloride (CAS 1333252-74-6) is a chemical compound with the molecular formula C13H15ClFN3 and a molecular weight of 267.73 g/mol. IUPAC name: 7-fluoro-4-piperazin-1-ylquinoline;hydrochloride. InChIKey: ZBBUDLMCELSBTG-UHFFFAOYSA-N.
| Molecular formula | C13H15ClFN3 |
|---|---|
| Molecular weight | 267.73 g/mol |
| IUPAC name | 7-fluoro-4-piperazin-1-ylquinoline;hydrochloride |
| InChIKey | ZBBUDLMCELSBTG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C=CC(=CC3=NC=C2)F.Cl |
Computed by PubChem (NCBI)