CAS 2503307-85-3 appears in our catalog under these names: 7-Fluoro-8-((triisopropylsilyl)ethynyl)naphthalen-1-ol, 95%, 95%, 7-Fluoro-8-((triisopropylsilyl)ethynyl)naphthalen-1-ol, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
7-fluoro-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-ol (CAS 2503307-85-3) is a chemical compound with the molecular formula C21H27FOSi and a molecular weight of 342.5 g/mol. IUPAC name: 7-fluoro-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-ol. InChIKey: DOHYFSCMTDZXIL-UHFFFAOYSA-N.
| Molecular formula | C21H27FOSi |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | 7-fluoro-8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-ol |
| InChIKey | DOHYFSCMTDZXIL-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C#CC1=C(C=CC2=C1C(=CC=C2)O)F)(C(C)C)C(C)C |
Computed by PubChem (NCBI)