cas: 41381-73-1 — see every product listed under this CAS number, including other names
7-Methoxy-2,2,4-trimethyl-1,2,3,4-tetrahydroquinoline 95% (CAS 41381-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1059790-100mg |
| cas | 41381-73-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1638.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1059790 |
7-methoxy-2,2,4-trimethyl-3,4-dihydro-1H-quinoline (CAS 41381-73-1) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: 7-methoxy-2,2,4-trimethyl-3,4-dihydro-1H-quinoline. InChIKey: JOQIPMNHEXDDIH-UHFFFAOYSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | 7-methoxy-2,2,4-trimethyl-3,4-dihydro-1H-quinoline |
| InChIKey | JOQIPMNHEXDDIH-UHFFFAOYSA-N |
| SMILES | CC1CC(NC2=C1C=CC(=C2)OC)(C)C |
Computed by PubChem (NCBI)