cas: 1810-74-8 — see every product listed under this CAS number, including other names
7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline 98% (CAS 1810-74-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A159272-250mg |
| cas | 1810-74-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 214.62 Pln | |
| Ambeed | 25g | 364.81 Pln | |
| Ambeed | 100g | 1026.75 Pln | |
| Ambeed | 500g | 3902.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A159272 |
7-methoxy-2,2,4-trimethyl-1H-quinoline (CAS 1810-74-8) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 7-methoxy-2,2,4-trimethyl-1H-quinoline. InChIKey: VNIQAUZZZWOJPT-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 7-methoxy-2,2,4-trimethyl-1H-quinoline |
| InChIKey | VNIQAUZZZWOJPT-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=CC(=C2)OC)(C)C |
Computed by PubChem (NCBI)