CAS 1810-74-8 appears in our catalog under these names: 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline, >95% (HPLC), 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline (>90%), 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline, 95% , 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline, 98%, 98%, 7-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline, 96%. Offered by: TRC, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 10g, 5g, 250mg, 25g, 100g, 500g.
7-methoxy-2,2,4-trimethyl-1H-quinoline (CAS 1810-74-8) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 7-methoxy-2,2,4-trimethyl-1H-quinoline. InChIKey: VNIQAUZZZWOJPT-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 7-methoxy-2,2,4-trimethyl-1H-quinoline |
| InChIKey | VNIQAUZZZWOJPT-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=CC(=C2)OC)(C)C |
Computed by PubChem (NCBI)