7-Methoxynaphthalen-2-amine, 97%
cas: 92287-46-2 — see every product listed under this CAS number, including other names
7-Methoxynaphthalen-2-amine, 97% (CAS 92287-46-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A399700-100mg |
| cas | 92287-46-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 654.06 Pln | |
| Ambeed | 250mg | 993.38 Pln | |
| Ambeed | 1g | 2467.44 Pln | |
| Ambeed | 5g | 5888.38 Pln | |
| BLDpharm | 100mg | 642.02 Pln | |
| BLDpharm | 250mg | 975.24 Pln | |
| BLDpharm | 1g | 2419.17 Pln | |
| BLDpharm | 5g | 5773.55 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 909.20 Pln | |
| Chemat | 1g | 2190.80 Pln | |
| Chemat | 5g | 5387.60 Pln | |
| Fluorochem | 1g | 4053.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
7-methoxynaphthalen-2-amine (CAS 92287-46-2) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 7-methoxynaphthalen-2-amine. InChIKey: OJRPPBXHGGSZIV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 7-methoxynaphthalen-2-amine |
| InChIKey | OJRPPBXHGGSZIV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC(=C2)N)C=C1 |
Computed by PubChem (NCBI)