cas: 1186334-60-0 — see every product listed under this CAS number, including other names
7-Methyl-1H-indazole-4-boronic acid pinacol ester, 95%, 95% (CAS 1186334-60-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DLNP-250mg |
| cas | 1186334-60-0 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 100mg | 347.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 1186334-60-0) is a chemical compound with the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. IUPAC name: 7-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: SZJKHXKVUGVPMO-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O2 |
|---|---|
| Molecular weight | 258.13 g/mol |
| IUPAC name | 7-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | SZJKHXKVUGVPMO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=NNC3=C(C=C2)C |
Computed by PubChem (NCBI)