7-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 97%
cas: 2248157-24-4 — see every product listed under this CAS number, including other names
7-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 97% (CAS 2248157-24-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUTX-100mg |
| cas | 2248157-24-4 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 808.40 Pln | |
| Chemat | 500mg | 1288.40 Pln | |
| Chemat | 1g | 2166.80 Pln | |
| Chemat | 5g | 6198.80 Pln | |
| Chemat | 10g | 10581.20 Pln | |
| Fluorochem | 100mg | 992.38 Pln | |
| Fluorochem | 250mg | 1497.41 Pln | |
| Fluorochem | 500mg | 2387.72 Pln | |
| Fluorochem | 1g | 4012.15 Pln | |
| Fluorochem | 5g | 11306.45 Pln | |
| Fluorochem | 10g | 19324.46 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2248157-24-4) is a chemical compound with the molecular formula C16H19BFNO3 and a molecular weight of 303.1 g/mol. IUPAC name: 7-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: KCDSWAUVPZUTCE-UHFFFAOYSA-N.
| Molecular formula | C16H19BFNO3 |
|---|---|
| Molecular weight | 303.1 g/mol |
| IUPAC name | 7-fluoro-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | KCDSWAUVPZUTCE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=C(C(=CC3=NC=C2)F)OC |
Computed by PubChem (NCBI)