cas: 13351-26-3 — see every product listed under this CAS number, including other names
8,9-Dihydro-5H-5,9-methanobenzo[7]annulen-7(6H)-one, 95%, 95% (CAS 13351-26-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110HLI-1g |
| cas | 13351-26-3 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1470.80 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 419.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one (CAS 13351-26-3) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one. InChIKey: KEACXSSYYTXFJR-UHFFFAOYSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | tricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one |
| InChIKey | KEACXSSYYTXFJR-UHFFFAOYSA-N |
| SMILES | C1C2CC(=O)CC1C3=CC=CC=C23 |
Computed by PubChem (NCBI)