8-((3R,4S)-4-Ethylpyrrolidin-3-yl)-3H-imidazo[1,2-a]pyrrolo[2,3-e]pyrazine dihydrochloride, 95%
cas: 2050038-84-9 — see every product listed under this CAS number, including other names
8-((3R,4S)-4-Ethylpyrrolidin-3-yl)-3H-imidazo[1,2-a]pyrrolo[2,3-e]pyrazine dihydrochloride, 95% (CAS 2050038-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1377841-100mg |
| cas | 2050038-84-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 993.38 Pln | |
| Ambeed | 250mg | 1443.94 Pln | |
| Ambeed | 1g | 2817.88 Pln | |
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1014.80 Pln | |
| Chemat | 5g | 2435.60 Pln | |
| BLDpharm | 100mg | 1064.09 Pln | |
| BLDpharm | 250mg | 1552.81 Pln | |
| BLDpharm | 1g | 3030.07 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
12-[(3R,4S)-4-ethylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;dihydrochloride (CAS 2050038-84-9) is a chemical compound with the molecular formula C14H19Cl2N5 and a molecular weight of 328.2 g/mol. IUPAC name: 12-[(3R,4S)-4-ethylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;dihydrochloride. InChIKey: LKVHWZCFMAQTFX-NKRBYZSKSA-N.
| Molecular formula | C14H19Cl2N5 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 12-[(3R,4S)-4-ethylpyrrolidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;dihydrochloride |
| InChIKey | LKVHWZCFMAQTFX-NKRBYZSKSA-N |
| SMILES | CC[C@@H]1CNC[C@@H]1C2=CN=C3N2C4=C(NC=C4)N=C3.Cl.Cl |
Computed by PubChem (NCBI)