cas: 149414-80-2 — see every product listed under this CAS number, including other names
8-[[(1,1-Dimethylethoxy)carbonyl]amino]-octanoic acid... (CAS 149414-80-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg. Offered by: Roth.
| brand | Roth |
|---|---|
| catalog number | ROTH-33C4.2 |
| cas | 149414-80-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Roth | 50mg | 844.81 Pln | |
| Roth | 100mg | 1345.09 Pln | |
| Roth | 250mg | 2496.67 Pln | |
| Roth | 500mg | 3988.07 Pln |
| delivery time | 2 week |
|---|
(2,5-dioxopyrrolidin-1-yl) 8-[(2-methylpropan-2-yl)oxycarbonylamino]octanoate (CAS 149414-80-2) is a chemical compound with the molecular formula C17H28N2O6 and a molecular weight of 356.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 8-[(2-methylpropan-2-yl)oxycarbonylamino]octanoate. InChIKey: VWJIIRILMYJMEF-UHFFFAOYSA-N.
| Molecular formula | C17H28N2O6 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 8-[(2-methylpropan-2-yl)oxycarbonylamino]octanoate |
| InChIKey | VWJIIRILMYJMEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)