CAS 217180-76-2 appears in our catalog under these names: N3-C7H14-COOH, 8-Azidooctanoic acid, 95%, 95%, (7-carboxyheptyl)(diazyn-1-ium-1-yl)azanide, 95%. Offered by: Iris Biotech, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g, 10g.
8-azidooctanoic acid (CAS 217180-76-2) is a chemical compound with the molecular formula C8H15N3O2 and a molecular weight of 185.22 g/mol. IUPAC name: 8-azidooctanoic acid. InChIKey: NIIORXIMUYSXDQ-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O2 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 8-azidooctanoic acid |
| InChIKey | NIIORXIMUYSXDQ-UHFFFAOYSA-N |
| SMILES | C(CCCC(=O)O)CCCN=[N+]=[N-] |
Computed by PubChem (NCBI)