cas: 170921-48-9 — see every product listed under this CAS number, including other names
8-Benzyl-1,3,8-triazaspiro[4.5]decan-4-one, 95%, 95% (CAS 170921-48-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ANHE-100mg |
| cas | 170921-48-9 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 654.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
8-benzyl-1,3,8-triazaspiro[4.5]decan-4-one (CAS 170921-48-9) is a chemical compound with the molecular formula C14H19N3O and a molecular weight of 245.32 g/mol. IUPAC name: 8-benzyl-1,3,8-triazaspiro[4.5]decan-4-one. InChIKey: BCWSNKPUZNJPGJ-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 8-benzyl-1,3,8-triazaspiro[4.5]decan-4-one |
| InChIKey | BCWSNKPUZNJPGJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12C(=O)NCN2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)