8-Bromo-2,4-dichloro-6-fluoroquinazoline, 97%
cas: 864292-32-0 — see every product listed under this CAS number, including other names
8-Bromo-2,4-dichloro-6-fluoroquinazoline, 97% (CAS 864292-32-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A652739-250mg |
| cas | 864292-32-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 709.69 Pln | |
| Ambeed | 1g | 1788.81 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 697.56 Pln | |
| BLDpharm | 1g | 1758.29 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 582.80 Pln | |
| Chemat | 500mg | 1096.40 Pln | |
| Chemat | 1g | 1461.20 Pln | |
| Fluorochem | 100mg | 768.50 Pln | |
| Fluorochem | 250mg | 1242.29 Pln | |
| Fluorochem | 1g | 3194.73 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
8-bromo-2,4-dichloro-6-fluoroquinazoline (CAS 864292-32-0) is a chemical compound with the molecular formula C8H2BrCl2FN2 and a molecular weight of 295.92 g/mol. IUPAC name: 8-bromo-2,4-dichloro-6-fluoroquinazoline. InChIKey: UOTCZWJWYOPOMP-UHFFFAOYSA-N.
| Molecular formula | C8H2BrCl2FN2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 8-bromo-2,4-dichloro-6-fluoroquinazoline |
| InChIKey | UOTCZWJWYOPOMP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NC(=N2)Cl)Cl)Br)F |
Computed by PubChem (NCBI)