cas: 1156602-22-0 — see every product listed under this CAS number, including other names
8-Bromo-4-chloro-6-methylquinoline, 98%, 98% (CAS 1156602-22-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111GOT-250mg |
| cas | 1156602-22-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 2680.40 Pln | |
| Chemat | 50mg | 98.00 Pln | |
| Chemat | 100mg | 126.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-bromo-4-chloro-6-methylquinoline (CAS 1156602-22-0) is a chemical compound with the molecular formula C10H7BrClN and a molecular weight of 256.52 g/mol. IUPAC name: 8-bromo-4-chloro-6-methylquinoline. InChIKey: XZLLMICSEAATSX-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClN |
|---|---|
| Molecular weight | 256.52 g/mol |
| IUPAC name | 8-bromo-4-chloro-6-methylquinoline |
| InChIKey | XZLLMICSEAATSX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CN=C2C(=C1)Br)Cl |
Computed by PubChem (NCBI)