cas: 84839-95-2 — see every product listed under this CAS number, including other names
8-Bromo-6-methylquinoline, 97% (CAS 84839-95-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215789-1G |
| cas | 84839-95-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 966.34 Pln | |
| Fluorochem | 10g | 1565.09 Pln | |
| Fluorochem | 25g | 3048.94 Pln | |
| Fluorochem | 100g | 10140.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
8-bromo-6-methylquinoline (CAS 84839-95-2) is a chemical compound with the molecular formula C10H8BrN and a molecular weight of 222.08 g/mol. IUPAC name: 8-bromo-6-methylquinoline. InChIKey: ONJNEQXRWAWITH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | 8-bromo-6-methylquinoline |
| InChIKey | ONJNEQXRWAWITH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)N=CC=C2 |
Computed by PubChem (NCBI)