8-Bromo-7H-benzo[c]carbazole, 98%
cas: 1686099-80-8 — see every product listed under this CAS number, including other names
8-Bromo-7H-benzo[c]carbazole, 98% (CAS 1686099-80-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1467062-250mg |
| cas | 1686099-80-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1043.44 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1077.20 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 1119.63 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 1992.02 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
8-bromo-7H-benzo[c]carbazole (CAS 1686099-80-8) is a chemical compound with the molecular formula C16H10BrN and a molecular weight of 296.16 g/mol. IUPAC name: 8-bromo-7H-benzo[c]carbazole. InChIKey: DKCRTNHVYZSJEH-UHFFFAOYSA-N.
| Molecular formula | C16H10BrN |
|---|---|
| Molecular weight | 296.16 g/mol |
| IUPAC name | 8-bromo-7H-benzo[c]carbazole |
| InChIKey | DKCRTNHVYZSJEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(N3)C(=CC=C4)Br |
Computed by PubChem (NCBI)