cas: 28121-73-5 — see every product listed under this CAS number, including other names
8-Cbz-2,4-dioxo-1,3,8-triazaspiro[4.5]decane, 95%, 95% (CAS 28121-73-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BG4Q-100mg |
| cas | 28121-73-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 419.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (CAS 28121-73-5) is a chemical compound with the molecular formula C15H17N3O4 and a molecular weight of 303.31 g/mol. IUPAC name: benzyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate. InChIKey: HGOPYEWWZGZVJI-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O4 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | benzyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| InChIKey | HGOPYEWWZGZVJI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12C(=O)NC(=O)N2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)