cas: 347146-21-8 — see every product listed under this CAS number, including other names
8-Chloroquinolin-3-amine, 98%, 98% (CAS 347146-21-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CMNR-100mg |
| cas | 347146-21-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 702.80 Pln | |
| Chemat | 250mg | 1082.00 Pln | |
| Chemat | 500mg | 1773.20 Pln | |
| Chemat | 1g | 2622.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-chloroquinolin-3-amine (CAS 347146-21-8) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 8-chloroquinolin-3-amine. InChIKey: AUEFQGAQNYYPQE-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 8-chloroquinolin-3-amine |
| InChIKey | AUEFQGAQNYYPQE-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)Cl)N |
Computed by PubChem (NCBI)