8-Chloroquinoline-2,3-dicarboxylic acid diethyl ester, 95%, 95%
cas: 892874-60-1 — see every product listed under this CAS number, including other names
8-Chloroquinoline-2,3-dicarboxylic acid diethyl ester, 95%, 95% (CAS 892874-60-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1151ZI-250mg |
| cas | 892874-60-1 |
| size | 250mg |
| availability | 3g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 500mg | 995.60 Pln | |
| Chemat | 1g | 1653.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Diethyl 8-chloroquinoline-2,3-dicarboxylate (CAS 892874-60-1) is a chemical compound with the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. IUPAC name: diethyl 8-chloroquinoline-2,3-dicarboxylate. InChIKey: YBUQJEUWEYOPBG-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO4 |
|---|---|
| Molecular weight | 307.73 g/mol |
| IUPAC name | diethyl 8-chloroquinoline-2,3-dicarboxylate |
| InChIKey | YBUQJEUWEYOPBG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C(=C1)C=CC=C2Cl)C(=O)OCC |
Computed by PubChem (NCBI)