cas: 1245644-74-9 — see every product listed under this CAS number, including other names
8-Fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine, 97%, 97% (CAS 1245644-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111MA1-100mg |
| cas | 1245644-74-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 1g | 1792.40 Pln | |
| Chemat | 5g | 6222.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1245644-74-9) is a chemical compound with the molecular formula C6H5FN4 and a molecular weight of 152.13 g/mol. IUPAC name: 8-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: OKZKUMNBFJSQTA-UHFFFAOYSA-N.
| Molecular formula | C6H5FN4 |
|---|---|
| Molecular weight | 152.13 g/mol |
| IUPAC name | 8-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | OKZKUMNBFJSQTA-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)N)C(=C1)F |
Computed by PubChem (NCBI)