8-Fluoro-3-iodoquinoline, 97%
cas: 866782-59-4 — see every product listed under this CAS number, including other names
8-Fluoro-3-iodoquinoline, 97% (CAS 866782-59-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A847594-250mg |
| cas | 866782-59-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 1232.56 Pln | |
| Ambeed | 25g | 5037.31 Pln | |
| Fluorochem | 100mg | 102.06 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| BLDpharm | 250mg | 169.96 Pln | |
| BLDpharm | 1g | 325.47 Pln | |
| BLDpharm | 5g | 1325.11 Pln | |
| BLDpharm | 25g | 4940.51 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
8-fluoro-3-iodoquinoline (CAS 866782-59-4) is a chemical compound with the molecular formula C9H5FIN and a molecular weight of 273.05 g/mol. IUPAC name: 8-fluoro-3-iodoquinoline. InChIKey: PFDRCQPNBZLTJQ-UHFFFAOYSA-N.
| Molecular formula | C9H5FIN |
|---|---|
| Molecular weight | 273.05 g/mol |
| IUPAC name | 8-fluoro-3-iodoquinoline |
| InChIKey | PFDRCQPNBZLTJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)F)I |
Computed by PubChem (NCBI)