cas: 148401-38-1 — see every product listed under this CAS number, including other names
8-Fluoroquinolin-4-amine, 98% (CAS 148401-38-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A474789-5g |
| cas | 148401-38-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3702.58 Pln | |
| AmBeed | 10g | 5460.28 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
8-fluoroquinolin-4-amine (CAS 148401-38-1) is a chemical compound with the molecular formula C9H7FN2 and a molecular weight of 162.16 g/mol. IUPAC name: 8-fluoroquinolin-4-amine. InChIKey: PFULPFXDXVNQCQ-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2 |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | 8-fluoroquinolin-4-amine |
| InChIKey | PFULPFXDXVNQCQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)F)N |
Computed by PubChem (NCBI)