cas: 51035-27-9 — see every product listed under this CAS number, including other names
8-Methoxy-2,2,4-trimethyl-1,2-dihydroquinoline 95% (CAS 51035-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A295532-100mg |
| cas | 51035-27-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 948.88 Pln | |
| Ambeed | 1g | 2267.19 Pln | |
| Ambeed | 5g | 8869.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A295532 |
8-methoxy-2,2,4-trimethyl-1H-quinoline (CAS 51035-27-9) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 8-methoxy-2,2,4-trimethyl-1H-quinoline. InChIKey: KRUCENDXMOILSL-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 8-methoxy-2,2,4-trimethyl-1H-quinoline |
| InChIKey | KRUCENDXMOILSL-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=CC=C2OC)(C)C |
Computed by PubChem (NCBI)