9'H-9,3':6',9''-Tercarbazole, 98%
cas: 606129-90-2 — see every product listed under this CAS number, including other names
9'H-9,3':6',9''-Tercarbazole, 98% (CAS 606129-90-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 100g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F626743-1G |
| cas | 606129-90-2 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 435.28 Pln | |
| Fluorochem | 5g | 1611.95 Pln | |
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 1805.50 Pln | |
| Ambeed | 25g | 6884.06 Pln | |
| Ambeed | 100g | 23098.75 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 569.82 Pln | |
| BLDpharm | 5g | 1941.56 Pln | |
| BLDpharm | 25g | 7417.41 Pln | |
| BLDpharm | 100g | 22689.81 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
3,6-di(carbazol-9-yl)-9H-carbazole (CAS 606129-90-2) is a chemical compound with the molecular formula C36H23N3 and a molecular weight of 497.6 g/mol. IUPAC name: 3,6-di(carbazol-9-yl)-9H-carbazole. InChIKey: OGDZAJUZGODBKX-UHFFFAOYSA-N.
| Molecular formula | C36H23N3 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | 3,6-di(carbazol-9-yl)-9H-carbazole |
| InChIKey | OGDZAJUZGODBKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC5=C(C=C4)NC6=C5C=C(C=C6)N7C8=CC=CC=C8C9=CC=CC=C97 |
Computed by PubChem (NCBI)