CAS 43217-31-8 appears in our catalog under these names: 9,10–Bis(4–Methylphenyl)–Anthracene, 9,10-Di-p-tolylanthracene, 97%, 97%, 9,10-Di-p-tolylanthracene, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
9,10-bis(4-methylphenyl)anthracene (CAS 43217-31-8) is a chemical compound with the molecular formula C28H22 and a molecular weight of 358.5 g/mol. IUPAC name: 9,10-bis(4-methylphenyl)anthracene. InChIKey: DNJUFDQOIUPQMN-UHFFFAOYSA-N.
| Molecular formula | C28H22 |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | 9,10-bis(4-methylphenyl)anthracene |
| InChIKey | DNJUFDQOIUPQMN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=C(C=C5)C |
Computed by PubChem (NCBI)