cas: 159-66-0 — see every product listed under this CAS number, including other names
9,9'-Spirobi[fluorene], 99%, 99% (CAS 159-66-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112R4G-1g |
| cas | 159-66-0 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 50g | 333.20 Pln | |
| Chemat | 100g | 602.00 Pln | |
| Chemat | 250g | 1370.00 Pln | |
| Chemat | 500g | 2611.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
9,9'-spirobi[fluorene] (CAS 159-66-0) is a chemical compound with the molecular formula C25H16 and a molecular weight of 316.4 g/mol. IUPAC name: 9,9'-spirobi[fluorene]. InChIKey: SNFCXVRWFNAHQX-UHFFFAOYSA-N.
| Molecular formula | C25H16 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 9,9'-spirobi[fluorene] |
| InChIKey | SNFCXVRWFNAHQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C24C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)