CAS 302554-81-0 appears in our catalog under these names: 9,9-Di-n-octylfluorene-2-boronic acid pinacol ester, 95-<97%, 9,9-Di-n-octylfluorene-2-boronic acid pinacol ester, ≥97-<99%, 2–(9,9–Dioctyl–9H–fluoren–2–yl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 9,9-Di-n-octylfluorene-2-boronic acid pinacol ester, 95% , 2-(9,9-Di-n-octyl-9H-fluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(HPLC)(T). Offered by: Hoffman Fine Chemicals, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 5g.
2-(9,9-dioctylfluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 302554-81-0) is a chemical compound with the molecular formula C35H53BO2 and a molecular weight of 516.6 g/mol. IUPAC name: 2-(9,9-dioctylfluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VOASJDUTCQKQLE-UHFFFAOYSA-N.
| Molecular formula | C35H53BO2 |
|---|---|
| Molecular weight | 516.6 g/mol |
| IUPAC name | 2-(9,9-dioctylfluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VOASJDUTCQKQLE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=CC=CC=C4C3(CCCCCCCC)CCCCCCCC |
Computed by PubChem (NCBI)