cas: 1195975-03-1 — see every product listed under this CAS number, including other names
9-([1,1'-Biphenyl]-4-yl)-10-bromo-2-phenylanthracene, 98%, 98% (CAS 1195975-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111P9B-100mg |
| cas | 1195975-03-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 621.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
10-bromo-2-phenyl-9-(4-phenylphenyl)anthracene (CAS 1195975-03-1) is a chemical compound with the molecular formula C32H21Br and a molecular weight of 485.4 g/mol. IUPAC name: 10-bromo-2-phenyl-9-(4-phenylphenyl)anthracene. InChIKey: NGUZRYYKSIYQOV-UHFFFAOYSA-N.
| Molecular formula | C32H21Br |
|---|---|
| Molecular weight | 485.4 g/mol |
| IUPAC name | 10-bromo-2-phenyl-9-(4-phenylphenyl)anthracene |
| InChIKey | NGUZRYYKSIYQOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=C4C=C(C=CC4=C(C5=CC=CC=C53)Br)C6=CC=CC=C6 |
Computed by PubChem (NCBI)