9-(3,5-Dibromophenyl)-9H-carbazole, 97%
cas: 750573-26-3 — see every product listed under this CAS number, including other names
9-(3,5-Dibromophenyl)-9H-carbazole, 97% (CAS 750573-26-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A225742-250mg |
| cas | 750573-26-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 492.75 Pln | |
| Ambeed | 10g | 820.94 Pln | |
| Ambeed | 25g | 1577.44 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 525.20 Pln | |
| Chemat | 25g | 1106.00 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 525.40 Pln | |
| BLDpharm | 10g | 880.83 Pln | |
| BLDpharm | 25g | 1697.20 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 25g | 1622.36 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
9-(3,5-dibromophenyl)carbazole (CAS 750573-26-3) is a chemical compound with the molecular formula C18H11Br2N and a molecular weight of 401.1 g/mol. IUPAC name: 9-(3,5-dibromophenyl)carbazole. InChIKey: YXHXRBIAIVNCPG-UHFFFAOYSA-N.
| Molecular formula | C18H11Br2N |
|---|---|
| Molecular weight | 401.1 g/mol |
| IUPAC name | 9-(3,5-dibromophenyl)carbazole |
| InChIKey | YXHXRBIAIVNCPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC(=CC(=C4)Br)Br |
Computed by PubChem (NCBI)