cas: 57102-42-8 — see every product listed under this CAS number, including other names
9-(4-Bromophenyl)-9H-carbazole, 98%, 98% (CAS 57102-42-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1kg, 5kg, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11488F-5g |
| cas | 57102-42-8 |
| size | 5g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 232.40 Pln | |
| Chemat | 1kg | 1634.00 Pln | |
| Chemat | 5kg | 8515.20 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9-(4-bromophenyl)carbazole (CAS 57102-42-8) is a chemical compound with the molecular formula C18H12BrN and a molecular weight of 322.2 g/mol. IUPAC name: 9-(4-bromophenyl)carbazole. InChIKey: XSDKKRKTDZMKCH-UHFFFAOYSA-N.
| Molecular formula | C18H12BrN |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | 9-(4-bromophenyl)carbazole |
| InChIKey | XSDKKRKTDZMKCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)