Products 2271196-04-2
CAS 2271196-04-2 is the registry number for 9-Chloronaphtho[1',2':4,5]furo[2,3-b]pyrazine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
14-chloro-11-oxa-13,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaene (CAS 2271196-04-2) is a chemical compound with the molecular formula C14H7ClN2O and a molecular weight of 254.67 g/mol. IUPAC name: 14-chloro-11-oxa-13,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaene. InChIKey: HFNIYMCBFSIFQQ-UHFFFAOYSA-N.
| Molecular formula | C14H7ClN2O |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 14-chloro-11-oxa-13,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| InChIKey | HFNIYMCBFSIFQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=NC=C(N=C4O3)Cl |
Computed by PubChem (NCBI)