cas: 149934-21-4 — see every product listed under this CAS number, including other names
9-Minocycline HCL, 96% HPLC, 96% HPLC (CAS 149934-21-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112M60-250mg |
| cas | 149934-21-4 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 458.00 Pln | |
| Chemat | 25g | 1821.20 Pln |
| purity | 96% HPLC |
|---|---|
| delivery time | 3 weeks |
(4S,4aS,5aR,12aR)-9-amino-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride (CAS 149934-21-4) is a chemical compound with the molecular formula C23H29ClN4O7 and a molecular weight of 508.9 g/mol. IUPAC name: (4S,4aS,5aR,12aR)-9-amino-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride. InChIKey: MQRUQMWLTBRONP-KBTHSJHISA-N.
| Molecular formula | C23H29ClN4O7 |
|---|---|
| Molecular weight | 508.9 g/mol |
| IUPAC name | (4S,4aS,5aR,12aR)-9-amino-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| InChIKey | MQRUQMWLTBRONP-KBTHSJHISA-N |
| SMILES | CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=C(C(=C4C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)N)O)O)O)O)N)N(C)C.Cl |
Computed by PubChem (NCBI)