cas: 98503-52-7 — see every product listed under this CAS number, including other names
9H-Fluoren-9-one,O-[(4-methylphenyl)sulfonyl]oxime, 95%, 95% (CAS 98503-52-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AUI-250mg |
| cas | 98503-52-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(fluoren-9-ylideneamino) 4-methylbenzenesulfonate (CAS 98503-52-7) is a chemical compound with the molecular formula C20H15NO3S and a molecular weight of 349.4 g/mol. IUPAC name: (fluoren-9-ylideneamino) 4-methylbenzenesulfonate. InChIKey: JORIDVBGYJPGCN-UHFFFAOYSA-N.
| Molecular formula | C20H15NO3S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (fluoren-9-ylideneamino) 4-methylbenzenesulfonate |
| InChIKey | JORIDVBGYJPGCN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ON=C2C3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)