cas: 623177-62-8 — see every product listed under this CAS number, including other names
9H-Fluoren-9-ylmethyl N-[(1R)-2-amino-1-(mercaptomethyl)-2-oxoethyl]carbamate, 95%, 95% (CAS 623177-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKQN-100mg |
| cas | 623177-62-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1850.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]carbamate (CAS 623177-62-8) is a chemical compound with the molecular formula C18H18N2O3S and a molecular weight of 342.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]carbamate. InChIKey: QNQILYKUOWQTEZ-INIZCTEOSA-N.
| Molecular formula | C18H18N2O3S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| InChIKey | QNQILYKUOWQTEZ-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CS)C(=O)N |
Computed by PubChem (NCBI)