cas: 1572510-80-5 — see every product listed under this CAS number, including other names
AB-423 99% (CAS 1572510-80-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A669689-25mg |
| cas | 1572510-80-5 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 665.19 Pln | |
| Ambeed | 50mg | 1087.94 Pln | |
| Ambeed | 100mg | 1788.81 Pln | |
| Ambeed | 250mg | 2984.75 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A669689 |
5-[[(2R)-butan-2-yl]sulfamoyl]-N-(3,4-difluorophenyl)-2-fluorobenzamide (CAS 1572510-80-5) is a chemical compound with the molecular formula C17H17F3N2O3S and a molecular weight of 386.4 g/mol. IUPAC name: 5-[[(2R)-butan-2-yl]sulfamoyl]-N-(3,4-difluorophenyl)-2-fluorobenzamide. InChIKey: BBLXLHYPDOMJMO-SNVBAGLBSA-N.
| Molecular formula | C17H17F3N2O3S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 5-[[(2R)-butan-2-yl]sulfamoyl]-N-(3,4-difluorophenyl)-2-fluorobenzamide |
| InChIKey | BBLXLHYPDOMJMO-SNVBAGLBSA-N |
| SMILES | CC[C@@H](C)NS(=O)(=O)C1=CC(=C(C=C1)F)C(=O)NC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)