cas: 113479-65-5 — see every product listed under this CAS number, including other names
ACLE HCL 95% (CAS 113479-65-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102740-500g |
| cas | 113479-65-5 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 22069.69 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 10g | 776.44 Pln | |
| Ambeed | 25g | 1788.81 Pln | |
| Ambeed | 100g | 5571.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A102740 |
(4-methoxyphenyl)methyl (6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride (CAS 113479-65-5) is a chemical compound with the molecular formula C16H18Cl2N2O4S and a molecular weight of 405.3 g/mol. IUPAC name: (4-methoxyphenyl)methyl (6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride. InChIKey: LYIIGHOYDRRHAJ-XRZFDKQNSA-N.
| Molecular formula | C16H18Cl2N2O4S |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | (4-methoxyphenyl)methyl (6R,7R)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
| InChIKey | LYIIGHOYDRRHAJ-XRZFDKQNSA-N |
| SMILES | COC1=CC=C(C=C1)COC(=O)C2=C(CS[C@H]3N2C(=O)[C@H]3N)CCl.Cl |
Computed by PubChem (NCBI)