AD-mix-β, 98%, 98%
cas: 148618-32-0 — see every product listed under this CAS number, including other names
AD-mix-β, 98%, 98% (CAS 148618-32-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112L4K-1g |
| cas | 148618-32-0 |
| size | 1g |
| availability | 25000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 448.40 Pln | |
| Chemat | 500g | 1977.60 Pln | |
| Chemat | 1kg | 3376.40 Pln | |
| Chemat | 50g | 261.20 Pln | |
| Chemat | 250g | 986.00 Pln | |
| Chemat | 5kg | 13017.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,4-bis[(S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]phthalazine (CAS 148618-32-0) is a chemical compound with the molecular formula C48H54N6O4 and a molecular weight of 779.0 g/mol. IUPAC name: 1,4-bis[(S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]phthalazine. InChIKey: YUCBLVFHJWOYDN-HVLQGHBFSA-N.
| Molecular formula | C48H54N6O4 |
|---|---|
| Molecular weight | 779.0 g/mol |
| IUPAC name | 1,4-bis[(S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]phthalazine |
| InChIKey | YUCBLVFHJWOYDN-HVLQGHBFSA-N |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=C4C=C(C=CC4=NC=C3)OC)OC5=NN=C(C6=CC=CC=C65)O[C@H]([C@H]7C[C@@H]8CCN7C[C@@H]8CC)C9=C1C=C(C=CC1=NC=C9)OC |
Computed by PubChem (NCBI)