cas: 171746-21-7 — see every product listed under this CAS number, including other names
AGN 193109 98% (CAS 171746-21-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A964784-1mg |
| cas | 171746-21-7 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 559.50 Pln | |
| Ambeed | 5mg | 804.25 Pln | |
| Ambeed | 10mg | 1015.62 Pln | |
| Ambeed | 25mg | 1638.62 Pln | |
| Ambeed | 50mg | 2545.31 Pln | |
| Ambeed | 100mg | 4542.25 Pln | |
| Ambeed | 250mg | 6772.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A964784 |
4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoic acid (CAS 171746-21-7) is a chemical compound with the molecular formula C28H24O2 and a molecular weight of 392.5 g/mol. IUPAC name: 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoic acid. InChIKey: NCEQLLNVRRTCKJ-UHFFFAOYSA-N.
| Molecular formula | C28H24O2 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 4-[2-[5,5-dimethyl-8-(4-methylphenyl)-6H-naphthalen-2-yl]ethynyl]benzoic acid |
| InChIKey | NCEQLLNVRRTCKJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CCC(C3=C2C=C(C=C3)C#CC4=CC=C(C=C4)C(=O)O)(C)C |
Computed by PubChem (NCBI)