ATX inhibitor 5
cas: 2402772-45-4 — see every product listed under this CAS number, including other names
ATX inhibitor 5 (CAS 2402772-45-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 200mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC62403-10 |
| cas | 2402772-45-4 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 2857.72 Pln | |
| GLPBio | 100mg | 10945.63 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1954.38 Pln | |
| GLPBio | 25mg | 5048.20 Pln | |
| GLPBio | 5mg | 1888.86 Pln | |
| GLPBio | 50mg | 7575.67 Pln | |
| Biosynth | 50mg | price on request | |
| Biosynth | 25mg | price on request | |
| Chemat | 1mg | 333.20 Pln | |
| Chemat | 5mg | 736.40 Pln | |
| Chemat | 10mg | 1106.00 Pln | |
| Chemat | 25mg | 1720.40 Pln | |
| Chemat | 50mg | 2325.20 Pln | |
| Chemat | 100mg | 3174.80 Pln | |
| Chemat | 200mg | 4264.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[(E)-(4-chlorophenyl)methylideneamino]-4-[3-(trifluoromethyl)anilino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide (CAS 2402772-45-4) is a chemical compound with the molecular formula C22H18ClF3N6O and a molecular weight of 474.9 g/mol. IUPAC name: N-[(E)-(4-chlorophenyl)methylideneamino]-4-[3-(trifluoromethyl)anilino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide. InChIKey: VHRNHTUEITYZIH-VPUKRXIYSA-N.
| Molecular formula | C22H18ClF3N6O |
|---|---|
| Molecular weight | 474.9 g/mol |
| IUPAC name | N-[(E)-(4-chlorophenyl)methylideneamino]-4-[3-(trifluoromethyl)anilino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
| InChIKey | VHRNHTUEITYZIH-VPUKRXIYSA-N |
| SMILES | C1CN(CC2=C1N=CN=C2NC3=CC=CC(=C3)C(F)(F)F)C(=O)N/N=C/C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)