AWZ1066S
cas: 2239272-16-1 — see every product listed under this CAS number, including other names
AWZ1066S (CAS 2239272-16-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 200mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC65120-1 |
| cas | 2239272-16-1 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 550.23 Pln | |
| GLPBio | 10mg | 962.12 Pln | |
| GLPBio | 25mg | 1425.49 Pln | |
| GLPBio | 5mg | 751.50 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 784.26 Pln | |
| GLPBio | 50mg | 1846.73 Pln | |
| Biosynth | 50mg | price on request | |
| Biosynth | 25mg | price on request | |
| Biosynth | 100mg | price on request | |
| Chemat | 1mg | 232.40 Pln | |
| Chemat | 5mg | 510.80 Pln | |
| Chemat | 10mg | 789.20 Pln | |
| Chemat | 25mg | 1422.80 Pln | |
| Chemat | 50mg | 1994.00 Pln | |
| Chemat | 100mg | 3203.60 Pln | |
| Chemat | 200mg | 4523.60 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(3S)-3-methylmorpholin-4-yl]-N-[[2-(trifluoromethyl)-3-pyridinyl]methyl]pyrido[2,3-d]pyrimidin-4-amine (CAS 2239272-16-1) is a chemical compound with the molecular formula C19H19F3N6O and a molecular weight of 404.4 g/mol. IUPAC name: 2-[(3S)-3-methylmorpholin-4-yl]-N-[[2-(trifluoromethyl)-3-pyridinyl]methyl]pyrido[2,3-d]pyrimidin-4-amine. InChIKey: IZFVCNUAPFSNCO-LBPRGKRZSA-N.
| Molecular formula | C19H19F3N6O |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 2-[(3S)-3-methylmorpholin-4-yl]-N-[[2-(trifluoromethyl)-3-pyridinyl]methyl]pyrido[2,3-d]pyrimidin-4-amine |
| InChIKey | IZFVCNUAPFSNCO-LBPRGKRZSA-N |
| SMILES | C[C@H]1COCCN1C2=NC3=C(C=CC=N3)C(=N2)NCC4=C(N=CC=C4)C(F)(F)F |
Computed by PubChem (NCBI)