cas: 1807537-41-2 — see every product listed under this CAS number, including other names
AZD-PEG2-PFP 95% (CAS 1807537-41-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754505-25mg |
| cas | 1807537-41-2 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 637.38 Pln | |
| Ambeed | 50mg | 1104.63 Pln | |
| Ambeed | 100mg | 1977.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A754505 |
(2,3,4,5,6-pentafluorophenyl) 3-[2-[3-oxo-3-[4-[3-oxo-3-(2-oxoazetidin-1-yl)propyl]anilino]propoxy]ethoxy]propanoate (CAS 1807537-41-2) is a chemical compound with the molecular formula C26H25F5N2O7 and a molecular weight of 572.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-[2-[3-oxo-3-[4-[3-oxo-3-(2-oxoazetidin-1-yl)propyl]anilino]propoxy]ethoxy]propanoate. InChIKey: MEJZOTXDECUGKM-UHFFFAOYSA-N.
| Molecular formula | C26H25F5N2O7 |
|---|---|
| Molecular weight | 572.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[3-oxo-3-[4-[3-oxo-3-(2-oxoazetidin-1-yl)propyl]anilino]propoxy]ethoxy]propanoate |
| InChIKey | MEJZOTXDECUGKM-UHFFFAOYSA-N |
| SMILES | C1CN(C1=O)C(=O)CCC2=CC=C(C=C2)NC(=O)CCOCCOCCC(=O)OC3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)