cas: 2857963-60-9 — see every product listed under this CAS number, including other names
Ac-Sar10, 98%, 98% (CAS 2857963-60-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1307EN-10g |
| cas | 2857963-60-9 |
| size | 10g |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 12645.20 Pln | |
| Chemat | 25g | 25638.80 Pln | |
| Chemat | 25mg | 438.80 Pln | |
| Chemat | 50mg | 650.00 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 3093.20 Pln | |
| Chemat | 5g | 8176.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[acetyl(methyl)amino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetic acid (CAS 2857963-60-9) is a chemical compound with the molecular formula C32H54N10O12 and a molecular weight of 770.8 g/mol. IUPAC name: 2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[acetyl(methyl)amino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetic acid. InChIKey: VBFSXYRMXNNFQG-UHFFFAOYSA-N.
| Molecular formula | C32H54N10O12 |
|---|---|
| Molecular weight | 770.8 g/mol |
| IUPAC name | 2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[acetyl(methyl)amino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetyl]-methylamino]acetic acid |
| InChIKey | VBFSXYRMXNNFQG-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)N(C)CC(=O)O |
Computed by PubChem (NCBI)