cas: 64291-41-4 — see every product listed under this CAS number, including other names
Acetagastrodin, ≥98%(HPLC), ≥98%(HPLC) (CAS 64291-41-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EHLK-5mg |
| cas | 64291-41-4 |
| size | 5mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 117.20 Pln | |
| Chemat | 10mg | 131.60 Pln | |
| Chemat | 50mg | 366.80 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1581.20 Pln | |
| Chemat | 1g | 4341.20 Pln | |
| Chemat | 5g | 17176.40 Pln |
| purity | ≥98%(HPLC) |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(hydroxymethyl)phenoxy]oxan-2-yl]methyl acetate (CAS 64291-41-4) is a chemical compound with the molecular formula C21H26O11 and a molecular weight of 454.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(hydroxymethyl)phenoxy]oxan-2-yl]methyl acetate. InChIKey: HGUDVDQXCUHOED-YMQHIKHWSA-N.
| Molecular formula | C21H26O11 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-(hydroxymethyl)phenoxy]oxan-2-yl]methyl acetate |
| InChIKey | HGUDVDQXCUHOED-YMQHIKHWSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)CO)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)