cas: 1895916-27-4 — see every product listed under this CAS number, including other names
Acid-PEG9-NHS ester 95% (CAS 1895916-27-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756084-50mg |
| cas | 1895916-27-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 615.13 Pln | |
| Ambeed | 100mg | 998.94 Pln | |
| Ambeed | 250mg | 1733.19 Pln | |
| Ambeed | 1g | 4397.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756084 |
3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1895916-27-4) is a chemical compound with the molecular formula C26H45NO15 and a molecular weight of 611.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: BJOKQEMLFQBOQZ-UHFFFAOYSA-N.
| Molecular formula | C26H45NO15 |
|---|---|
| Molecular weight | 611.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | BJOKQEMLFQBOQZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)