cas: 66074-67-7 — see every product listed under this CAS number, including other names
Acridine-9-carbonyl chloride 95% (CAS 66074-67-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A982985-250mg |
| cas | 66074-67-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2567.56 Pln | |
| Ambeed | 10g | 4264.13 Pln | |
| Ambeed | 25g | 8419.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A982985 |
Acridine-9-carbonyl chloride (CAS 66074-67-7) is a chemical compound with the molecular formula C14H8ClNO and a molecular weight of 241.67 g/mol. IUPAC name: acridine-9-carbonyl chloride. InChIKey: POZJERCVPSQRFG-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | acridine-9-carbonyl chloride |
| InChIKey | POZJERCVPSQRFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)C(=O)Cl |
Computed by PubChem (NCBI)