cas: 52175-10-7 — see every product listed under this CAS number, including other names
Adenine phosphate, 98%, 98% (CAS 52175-10-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0BX-100g |
| cas | 52175-10-7 |
| size | 100g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 184.40 Pln | |
| Chemat | 500g | 576.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Phosphoric acid;7H-purin-6-amine (CAS 52175-10-7) is a chemical compound with the molecular formula C5H8N5O4P and a molecular weight of 233.12 g/mol. IUPAC name: phosphoric acid;7H-purin-6-amine. InChIKey: CCHNOBQMQBSRHQ-UHFFFAOYSA-N.
| Molecular formula | C5H8N5O4P |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | phosphoric acid;7H-purin-6-amine |
| InChIKey | CCHNOBQMQBSRHQ-UHFFFAOYSA-N |
| SMILES | C1=NC2=NC=NC(=C2N1)N.OP(=O)(O)O |
Computed by PubChem (NCBI)